4-{[6-methyl-2-(phenylsulfanyl)quinolin-3-yl]methylidene}-2-phenyl-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
4-{[6-methyl-2-(phenylsulfanyl)quinolin-3-yl]methylidene}-2-phenyl-1,3-oxazol-5(4H)-one
4-{[6-methyl-2-(phenylsulfanyl)quinolin-3-yl]methylidene}-2-phenyl-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | 5141-0276 |
| Compound Name: | 4-{[6-methyl-2-(phenylsulfanyl)quinolin-3-yl]methylidene}-2-phenyl-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 422.5 |
| Molecular Formula: | C26 H18 N2 O2 S |
| Smiles: | Cc1ccc2c(c1)cc(\C=C1/C(=O)OC(c3ccccc3)=N1)c(n2)Sc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 6.4849 |
| logD: | 6.4849 |
| logSw: | -5.8783 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 38.566 |
| InChI Key: | AHKVESBFWMFEDE-UHFFFAOYSA-N |