1-(3,4-dimethoxyphenyl)-N-[(8,8,10,10-tetramethyl-8,9,10,11-tetrahydropyrido[4',3':4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidin-2-yl)methoxy]methanimine
Chemical Structure Depiction of
1-(3,4-dimethoxyphenyl)-N-[(8,8,10,10-tetramethyl-8,9,10,11-tetrahydropyrido[4',3':4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidin-2-yl)methoxy]methanimine
1-(3,4-dimethoxyphenyl)-N-[(8,8,10,10-tetramethyl-8,9,10,11-tetrahydropyrido[4',3':4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidin-2-yl)methoxy]methanimine
Compound characteristics
| Compound ID: | 5169-0002 |
| Compound Name: | 1-(3,4-dimethoxyphenyl)-N-[(8,8,10,10-tetramethyl-8,9,10,11-tetrahydropyrido[4',3':4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidin-2-yl)methoxy]methanimine |
| Molecular Weight: | 480.59 |
| Molecular Formula: | C24 H28 N6 O3 S |
| Smiles: | CC1(C)Cc2c3c4nc(CO/N=C\c5ccc(c(c5)OC)OC)nn4C=Nc3sc2C(C)(C)N1 |
| Stereo: | ACHIRAL |
| logP: | 3.6136 |
| logD: | 3.5355 |
| logSw: | -4.1598 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.479 |
| InChI Key: | XKDOAADHHRKYIN-UHFFFAOYSA-N |