2-(4-fluorophenyl)-8,9,10,11-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Chemical Structure Depiction of
2-(4-fluorophenyl)-8,9,10,11-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
2-(4-fluorophenyl)-8,9,10,11-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Compound characteristics
| Compound ID: | 5169-0459 |
| Compound Name: | 2-(4-fluorophenyl)-8,9,10,11-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine |
| Molecular Weight: | 324.38 |
| Molecular Formula: | C17 H13 F N4 S |
| Smiles: | C1CCc2c(C1)c1c3nc(c4ccc(cc4)F)nn3C=Nc1s2 |
| Stereo: | ACHIRAL |
| logP: | 4.1274 |
| logD: | 4.1272 |
| logSw: | -4.5978 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 33.576 |
| InChI Key: | XJFSLQJOUXBSRV-UHFFFAOYSA-N |