dimethyl 1-[2-(4-methoxyphenyl)ethyl]-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate
Chemical Structure Depiction of
dimethyl 1-[2-(4-methoxyphenyl)ethyl]-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate
dimethyl 1-[2-(4-methoxyphenyl)ethyl]-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate
Compound characteristics
| Compound ID: | 5198-8091 |
| Compound Name: | dimethyl 1-[2-(4-methoxyphenyl)ethyl]-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Weight: | 475.46 |
| Molecular Formula: | C25 H24 F3 N O5 |
| Smiles: | COC(C1=CN(CCc2ccc(cc2)OC)C=C(C1c1ccccc1C(F)(F)F)C(=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6731 |
| logD: | 4.6731 |
| logSw: | -4.513 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.799 |
| InChI Key: | RQLJORKQKXGKOG-UHFFFAOYSA-N |