ethyl 2-(4-chlorophenyl)-3-cyclohexyl-5-methyl-4-oxo-1,2,3,4-tetrahydrothieno[3,4-d]pyrimidine-7-carboxylate
Chemical Structure Depiction of
ethyl 2-(4-chlorophenyl)-3-cyclohexyl-5-methyl-4-oxo-1,2,3,4-tetrahydrothieno[3,4-d]pyrimidine-7-carboxylate
ethyl 2-(4-chlorophenyl)-3-cyclohexyl-5-methyl-4-oxo-1,2,3,4-tetrahydrothieno[3,4-d]pyrimidine-7-carboxylate
Compound characteristics
| Compound ID: | 5205-0020 |
| Compound Name: | ethyl 2-(4-chlorophenyl)-3-cyclohexyl-5-methyl-4-oxo-1,2,3,4-tetrahydrothieno[3,4-d]pyrimidine-7-carboxylate |
| Molecular Weight: | 432.97 |
| Molecular Formula: | C22 H25 Cl N2 O3 S |
| Smiles: | CCOC(c1c2c(C(N(C3CCCCC3)C(c3ccc(cc3)[Cl])N2)=O)c(C)s1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3677 |
| logD: | 5.3675 |
| logSw: | -6.2954 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.084 |
| InChI Key: | DCAXIOCLOFBJQH-FQEVSTJZSA-N |