N~2~-[(furan-2-yl)methyl]-N-[4-(propan-2-yl)phenyl]asparagine
Chemical Structure Depiction of
N~2~-[(furan-2-yl)methyl]-N-[4-(propan-2-yl)phenyl]asparagine
N~2~-[(furan-2-yl)methyl]-N-[4-(propan-2-yl)phenyl]asparagine
Compound characteristics
| Compound ID: | 5225-6561 |
| Compound Name: | N~2~-[(furan-2-yl)methyl]-N-[4-(propan-2-yl)phenyl]asparagine |
| Molecular Weight: | 330.38 |
| Molecular Formula: | C18 H22 N2 O4 |
| Smiles: | [H]N(Cc1ccco1)C(CC(N([H])c1ccc(cc1)C(C)C)=O)C(=O)O[H] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.8199 |
| logD: | -1.1363 |
| logSw: | -2.0759 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 70.732 |
| InChI Key: | OLGCDGBPUUSFOJ-INIZCTEOSA-N |