3-[7-(2-chlorophenyl)-5-(4-methoxyphenyl)-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propan-1-ol
Chemical Structure Depiction of
3-[7-(2-chlorophenyl)-5-(4-methoxyphenyl)-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propan-1-ol
3-[7-(2-chlorophenyl)-5-(4-methoxyphenyl)-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propan-1-ol
Compound characteristics
| Compound ID: | 5228-4342 |
| Compound Name: | 3-[7-(2-chlorophenyl)-5-(4-methoxyphenyl)-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propan-1-ol |
| Molecular Weight: | 396.88 |
| Molecular Formula: | C21 H21 Cl N4 O2 |
| Smiles: | COc1ccc(cc1)C1=CC(c2ccccc2[Cl])n2c(N1)nc(CCCO)n2 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8894 |
| logD: | 3.8853 |
| logSw: | -4.2478 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.849 |
| InChI Key: | IUAIGXRURCACJM-IBGZPJMESA-N |