[4-({4-[4-methyl-3-(4-methylpiperazine-1-sulfonyl)phenyl]phthalazin-1-yl}amino)phenyl](piperidin-1-yl)methanone
Chemical Structure Depiction of
[4-({4-[4-methyl-3-(4-methylpiperazine-1-sulfonyl)phenyl]phthalazin-1-yl}amino)phenyl](piperidin-1-yl)methanone
[4-({4-[4-methyl-3-(4-methylpiperazine-1-sulfonyl)phenyl]phthalazin-1-yl}amino)phenyl](piperidin-1-yl)methanone
Compound characteristics
| Compound ID: | 5233-2318 |
| Compound Name: | [4-({4-[4-methyl-3-(4-methylpiperazine-1-sulfonyl)phenyl]phthalazin-1-yl}amino)phenyl](piperidin-1-yl)methanone |
| Molecular Weight: | 584.74 |
| Molecular Formula: | C32 H36 N6 O3 S |
| Smiles: | Cc1ccc(cc1S(N1CCN(C)CC1)(=O)=O)c1c2ccccc2c(Nc2ccc(cc2)C(N2CCCCC2)=O)nn1 |
| Stereo: | ACHIRAL |
| logP: | 4.2906 |
| logD: | 4.228 |
| logSw: | -4.1673 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 83.597 |
| InChI Key: | OYXKPSQIXHTXLQ-UHFFFAOYSA-N |