N-(5-fluoro-2-methylphenyl)-2-({5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(5-fluoro-2-methylphenyl)-2-({5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl}sulfanyl)acetamide
N-(5-fluoro-2-methylphenyl)-2-({5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | 5242-1116 |
| Compound Name: | N-(5-fluoro-2-methylphenyl)-2-({5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl}sulfanyl)acetamide |
| Molecular Weight: | 387.43 |
| Molecular Formula: | C19 H18 F N3 O3 S |
| Smiles: | Cc1ccc(cc1NC(CSc1nnc(Cc2ccc(cc2)OC)o1)=O)F |
| Stereo: | ACHIRAL |
| logP: | 2.9026 |
| logD: | 2.9024 |
| logSw: | -3.3315 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.725 |
| InChI Key: | OPVAKUHYCZRZHA-UHFFFAOYSA-N |