3-{1-(2-hydroxyethyl)-2-[(2-methylphenyl)methylidene]hydrazinyl}-1H-1lambda~6~,2-benzothiazole-1,1-dione
Chemical Structure Depiction of
3-{1-(2-hydroxyethyl)-2-[(2-methylphenyl)methylidene]hydrazinyl}-1H-1lambda~6~,2-benzothiazole-1,1-dione
3-{1-(2-hydroxyethyl)-2-[(2-methylphenyl)methylidene]hydrazinyl}-1H-1lambda~6~,2-benzothiazole-1,1-dione
Compound characteristics
| Compound ID: | 5251-2386 |
| Compound Name: | 3-{1-(2-hydroxyethyl)-2-[(2-methylphenyl)methylidene]hydrazinyl}-1H-1lambda~6~,2-benzothiazole-1,1-dione |
| Molecular Weight: | 343.4 |
| Molecular Formula: | C17 H17 N3 O3 S |
| Smiles: | Cc1ccccc1/C=N/N(CCO)C1c2ccccc2S(N=1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9912 |
| logD: | 1.9912 |
| logSw: | -2.5433 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.829 |
| InChI Key: | KLLQHWJZYUTAGC-UHFFFAOYSA-N |