N-{4-[1-(2-carbamothioylhydrazinylidene)ethyl]phenyl}-4-fluorobenzamide
					Chemical Structure Depiction of
N-{4-[1-(2-carbamothioylhydrazinylidene)ethyl]phenyl}-4-fluorobenzamide
			N-{4-[1-(2-carbamothioylhydrazinylidene)ethyl]phenyl}-4-fluorobenzamide
Compound characteristics
| Compound ID: | 5260-0052 | 
| Compound Name: | N-{4-[1-(2-carbamothioylhydrazinylidene)ethyl]phenyl}-4-fluorobenzamide | 
| Molecular Weight: | 330.38 | 
| Molecular Formula: | C16 H15 F N4 O S | 
| Smiles: | C\C(c1ccc(cc1)NC(c1ccc(cc1)F)=O)=N/NC(N)=S | 
| Stereo: | ACHIRAL | 
| logP: | 2.9037 | 
| logD: | 2.8966 | 
| logSw: | -3.5092 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 4 | 
| Polar surface area: | 64.426 | 
| InChI Key: | HURYHTHNBDKPEU-UHFFFAOYSA-N | 
 
				 
				