2-{2,7-bis[(2-methylphenyl)sulfamoyl]-9H-fluoren-9-ylidene}hydrazine-1-carboxamide
Chemical Structure Depiction of
2-{2,7-bis[(2-methylphenyl)sulfamoyl]-9H-fluoren-9-ylidene}hydrazine-1-carboxamide
2-{2,7-bis[(2-methylphenyl)sulfamoyl]-9H-fluoren-9-ylidene}hydrazine-1-carboxamide
Compound characteristics
| Compound ID: | 5267-1213 |
| Compound Name: | 2-{2,7-bis[(2-methylphenyl)sulfamoyl]-9H-fluoren-9-ylidene}hydrazine-1-carboxamide |
| Molecular Weight: | 575.66 |
| Molecular Formula: | C28 H25 N5 O5 S2 |
| Smiles: | Cc1ccccc1NS(c1ccc2c3ccc(cc3C(c2c1)=NNC(N)=O)S(Nc1ccccc1C)(=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0141 |
| logD: | 4.9857 |
| logSw: | -4.7339 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 5 |
| Polar surface area: | 135.009 |
| InChI Key: | AWVMOUNTJWGXRL-UHFFFAOYSA-N |