6,6'-[(9-oxo-9H-fluorene-2,7-diyl)bis(sulfonylazanediyl)]dihexanoic acid
					Chemical Structure Depiction of
6,6'-[(9-oxo-9H-fluorene-2,7-diyl)bis(sulfonylazanediyl)]dihexanoic acid
			6,6'-[(9-oxo-9H-fluorene-2,7-diyl)bis(sulfonylazanediyl)]dihexanoic acid
Compound characteristics
| Compound ID: | 5267-1325 | 
| Compound Name: | 6,6'-[(9-oxo-9H-fluorene-2,7-diyl)bis(sulfonylazanediyl)]dihexanoic acid | 
| Molecular Weight: | 566.65 | 
| Molecular Formula: | C25 H30 N2 O9 S2 | 
| Smiles: | C(CCC(O)=O)CCNS(c1ccc2c3ccc(cc3C(c2c1)=O)S(NCCCCCC(O)=O)(=O)=O)(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 2.1588 | 
| logD: | -0.6694 | 
| logSw: | -2.8269 | 
| Hydrogen bond acceptors count: | 18 | 
| Hydrogen bond donors count: | 4 | 
| Polar surface area: | 153.91 | 
| InChI Key: | KOMJGVIANLPDHB-UHFFFAOYSA-N | 
 
				 
				