N-[(2,4-dichlorophenyl)(8-hydroxyquinolin-7-yl)methyl]-3-methylbutanamide
Chemical Structure Depiction of
N-[(2,4-dichlorophenyl)(8-hydroxyquinolin-7-yl)methyl]-3-methylbutanamide
N-[(2,4-dichlorophenyl)(8-hydroxyquinolin-7-yl)methyl]-3-methylbutanamide
Compound characteristics
| Compound ID: | 5275-0009 |
| Compound Name: | N-[(2,4-dichlorophenyl)(8-hydroxyquinolin-7-yl)methyl]-3-methylbutanamide |
| Molecular Weight: | 403.31 |
| Molecular Formula: | C21 H20 Cl2 N2 O2 |
| Smiles: | CC(C)CC(NC(c1ccc(cc1[Cl])[Cl])c1ccc2cccnc2c1O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6856 |
| logD: | 5.6832 |
| logSw: | -5.649 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.803 |
| InChI Key: | RYNCRISZMOBICO-FQEVSTJZSA-N |