N-{(5-chloro-8-hydroxyquinolin-7-yl)[4-(diethylamino)phenyl]methyl}butanamide
Chemical Structure Depiction of
N-{(5-chloro-8-hydroxyquinolin-7-yl)[4-(diethylamino)phenyl]methyl}butanamide
N-{(5-chloro-8-hydroxyquinolin-7-yl)[4-(diethylamino)phenyl]methyl}butanamide
Compound characteristics
| Compound ID: | 5275-0060 |
| Compound Name: | N-{(5-chloro-8-hydroxyquinolin-7-yl)[4-(diethylamino)phenyl]methyl}butanamide |
| Molecular Weight: | 425.96 |
| Molecular Formula: | C24 H28 Cl N3 O2 |
| Smiles: | CCCC(NC(c1ccc(cc1)N(CC)CC)c1cc(c2cccnc2c1O)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3332 |
| logD: | 5.0555 |
| logSw: | -5.7457 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.539 |
| InChI Key: | WHQCGANOTXJOPB-QFIPXVFZSA-N |