1-{4-[(2-chloro-5-fluoropyrimidin-4-yl)oxy]phenyl}-N-(4H-1,2,4-triazol-4-yl)methanimine
Chemical Structure Depiction of
1-{4-[(2-chloro-5-fluoropyrimidin-4-yl)oxy]phenyl}-N-(4H-1,2,4-triazol-4-yl)methanimine
1-{4-[(2-chloro-5-fluoropyrimidin-4-yl)oxy]phenyl}-N-(4H-1,2,4-triazol-4-yl)methanimine
Compound characteristics
| Compound ID: | 5277-0392 |
| Compound Name: | 1-{4-[(2-chloro-5-fluoropyrimidin-4-yl)oxy]phenyl}-N-(4H-1,2,4-triazol-4-yl)methanimine |
| Molecular Weight: | 318.69 |
| Molecular Formula: | C13 H8 Cl F N6 O |
| Smiles: | C(\c1ccc(cc1)Oc1c(cnc(n1)[Cl])F)=N/n1cnnc1 |
| Stereo: | ACHIRAL |
| logP: | 1.6129 |
| logD: | 1.6113 |
| logSw: | -2.39 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 60.538 |
| InChI Key: | CDYDBIHTDBOTQT-UHFFFAOYSA-N |