3-methyl-N-[(2-oxothiolan-3-yl)carbamothioyl]-1-phenyl-1H-thieno[2,3-c]pyrazole-5-carboxamide
Chemical Structure Depiction of
3-methyl-N-[(2-oxothiolan-3-yl)carbamothioyl]-1-phenyl-1H-thieno[2,3-c]pyrazole-5-carboxamide
3-methyl-N-[(2-oxothiolan-3-yl)carbamothioyl]-1-phenyl-1H-thieno[2,3-c]pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | 5310-3956 |
| Compound Name: | 3-methyl-N-[(2-oxothiolan-3-yl)carbamothioyl]-1-phenyl-1H-thieno[2,3-c]pyrazole-5-carboxamide |
| Molecular Weight: | 416.54 |
| Molecular Formula: | C18 H16 N4 O2 S3 |
| Smiles: | Cc1c2cc(C(NC(NC3CCSC3=O)=S)=O)sc2n(c2ccccc2)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8987 |
| logD: | 2.8987 |
| logSw: | -3.4425 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.89 |
| InChI Key: | FZQBXFNGQPOWIY-ZDUSSCGKSA-N |