7,7-dimethyl-1-(4-methylphenyl)-2,5-dioxo-N-phenyl-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
Chemical Structure Depiction of
7,7-dimethyl-1-(4-methylphenyl)-2,5-dioxo-N-phenyl-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
7,7-dimethyl-1-(4-methylphenyl)-2,5-dioxo-N-phenyl-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | 5312-0059 |
| Compound Name: | 7,7-dimethyl-1-(4-methylphenyl)-2,5-dioxo-N-phenyl-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide |
| Molecular Weight: | 400.48 |
| Molecular Formula: | C25 H24 N2 O3 |
| Smiles: | Cc1ccc(cc1)N1C2CC(C)(C)CC(C=2C=C(C(Nc2ccccc2)=O)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7453 |
| logD: | 3.7395 |
| logSw: | -4.1126 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.671 |
| InChI Key: | XPFFVAARTCALQP-UHFFFAOYSA-N |