3-amino-N-(3-chloro-4-fluorophenyl)-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide
Chemical Structure Depiction of
3-amino-N-(3-chloro-4-fluorophenyl)-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide
3-amino-N-(3-chloro-4-fluorophenyl)-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide
Compound characteristics
| Compound ID: | 5350-0229 |
| Compound Name: | 3-amino-N-(3-chloro-4-fluorophenyl)-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| Molecular Weight: | 403.9 |
| Molecular Formula: | C20 H19 Cl F N3 O S |
| Smiles: | CCC1CCc2c(C1)cc1c(c(C(Nc3ccc(c(c3)[Cl])F)=O)sc1n2)N |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.7942 |
| logD: | 5.7678 |
| logSw: | -5.9527 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 53.858 |
| InChI Key: | CNOFJKLLBRAGFL-SNVBAGLBSA-N |