1-[(4-chlorophenyl)methyl]-3-[2-(2,5-dimethoxyphenyl)-2-oxoethyl]-3-hydroxy-1,3-dihydro-2H-indol-2-one
Chemical Structure Depiction of
1-[(4-chlorophenyl)methyl]-3-[2-(2,5-dimethoxyphenyl)-2-oxoethyl]-3-hydroxy-1,3-dihydro-2H-indol-2-one
1-[(4-chlorophenyl)methyl]-3-[2-(2,5-dimethoxyphenyl)-2-oxoethyl]-3-hydroxy-1,3-dihydro-2H-indol-2-one
Compound characteristics
| Compound ID: | 5353-0951 |
| Compound Name: | 1-[(4-chlorophenyl)methyl]-3-[2-(2,5-dimethoxyphenyl)-2-oxoethyl]-3-hydroxy-1,3-dihydro-2H-indol-2-one |
| Molecular Weight: | 451.91 |
| Molecular Formula: | C25 H22 Cl N O5 |
| Smiles: | COc1ccc(c(c1)C(CC1(C(N(Cc2ccc(cc2)[Cl])c2ccccc12)=O)O)=O)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2621 |
| logD: | 4.2621 |
| logSw: | -4.5618 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.217 |
| InChI Key: | MDVXMQVMIWCPEN-VWLOTQADSA-N |