ethyl {3-[(2-fluorophenyl)methyl]-2-imino-2,3-dihydro-1H-benzimidazol-1-yl}acetate--hydrogen chloride (1/1)
Chemical Structure Depiction of
ethyl {3-[(2-fluorophenyl)methyl]-2-imino-2,3-dihydro-1H-benzimidazol-1-yl}acetate--hydrogen chloride (1/1)
ethyl {3-[(2-fluorophenyl)methyl]-2-imino-2,3-dihydro-1H-benzimidazol-1-yl}acetate--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 5390-1466 |
| Compound Name: | ethyl {3-[(2-fluorophenyl)methyl]-2-imino-2,3-dihydro-1H-benzimidazol-1-yl}acetate--hydrogen chloride (1/1) |
| Molecular Weight: | 363.82 |
| Molecular Formula: | C18 H18 F N3 O2 |
| Salt: | HCl |
| Smiles: | CCOC(CN1C(=N)N(Cc2ccccc2F)c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4325 |
| logD: | 2.809 |
| logSw: | -3.4936 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.013 |
| InChI Key: | KNGMPKXLJRYQNI-UHFFFAOYSA-N |