3-[5-(4-chlorophenyl)-1-(2,4-dimethylphenyl)-1H-pyrrol-2-yl]propanoic acid
Chemical Structure Depiction of
3-[5-(4-chlorophenyl)-1-(2,4-dimethylphenyl)-1H-pyrrol-2-yl]propanoic acid
3-[5-(4-chlorophenyl)-1-(2,4-dimethylphenyl)-1H-pyrrol-2-yl]propanoic acid
Compound characteristics
| Compound ID: | 5408-2374 |
| Compound Name: | 3-[5-(4-chlorophenyl)-1-(2,4-dimethylphenyl)-1H-pyrrol-2-yl]propanoic acid |
| Molecular Weight: | 353.85 |
| Molecular Formula: | C21 H20 Cl N O2 |
| Smiles: | Cc1ccc(c(C)c1)n1c(CCC(O)=O)ccc1c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.9339 |
| logD: | 3.1201 |
| logSw: | -5.8018 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.4784 |
| InChI Key: | DGOHYHFWSWRIRL-UHFFFAOYSA-N |