N'-[(4-methoxyphenyl)methylidene]-1-methyl-1H-indole-3-carbohydrazide
Chemical Structure Depiction of
N'-[(4-methoxyphenyl)methylidene]-1-methyl-1H-indole-3-carbohydrazide
N'-[(4-methoxyphenyl)methylidene]-1-methyl-1H-indole-3-carbohydrazide
Compound characteristics
| Compound ID: | 5432-0049 |
| Compound Name: | N'-[(4-methoxyphenyl)methylidene]-1-methyl-1H-indole-3-carbohydrazide |
| Molecular Weight: | 307.35 |
| Molecular Formula: | C18 H17 N3 O2 |
| Smiles: | Cn1cc(C(N/N=C/c2ccc(cc2)OC)=O)c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 3.0141 |
| logD: | 3.014 |
| logSw: | -3.3724 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.658 |
| InChI Key: | GGCCJDYMQGFMMJ-UHFFFAOYSA-N |