2,4-dimethyl-3-phenyl-9,10-dihydrocyclopenta[c]furo[2,3-f][1]benzopyran-7(8H)-one
Chemical Structure Depiction of
2,4-dimethyl-3-phenyl-9,10-dihydrocyclopenta[c]furo[2,3-f][1]benzopyran-7(8H)-one
2,4-dimethyl-3-phenyl-9,10-dihydrocyclopenta[c]furo[2,3-f][1]benzopyran-7(8H)-one
Compound characteristics
| Compound ID: | 5436-1117 |
| Compound Name: | 2,4-dimethyl-3-phenyl-9,10-dihydrocyclopenta[c]furo[2,3-f][1]benzopyran-7(8H)-one |
| Molecular Weight: | 330.38 |
| Molecular Formula: | C22 H18 O3 |
| Smiles: | Cc1cc2c(C3CCCC=3C(=O)O2)c2c1c(c1ccccc1)c(C)o2 |
| Stereo: | ACHIRAL |
| logP: | 5.0821 |
| logD: | 5.0821 |
| logSw: | -5.2364 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.3555 |
| InChI Key: | DWJMVWVSFXIVMQ-UHFFFAOYSA-N |