9-ethyl-3-(3-methoxyphenyl)-4-methyl-7H-furo[2,3-f][1]benzopyran-7-one
Chemical Structure Depiction of
9-ethyl-3-(3-methoxyphenyl)-4-methyl-7H-furo[2,3-f][1]benzopyran-7-one
9-ethyl-3-(3-methoxyphenyl)-4-methyl-7H-furo[2,3-f][1]benzopyran-7-one
Compound characteristics
| Compound ID: | 5436-1298 |
| Compound Name: | 9-ethyl-3-(3-methoxyphenyl)-4-methyl-7H-furo[2,3-f][1]benzopyran-7-one |
| Molecular Weight: | 334.37 |
| Molecular Formula: | C21 H18 O4 |
| Smiles: | CCC1=CC(=O)Oc2cc(C)c3c(coc3c12)c1cccc(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 4.8311 |
| logD: | 4.8311 |
| logSw: | -4.938 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.711 |
| InChI Key: | NHHVRHIRXOMYJB-UHFFFAOYSA-N |