8-(2-methylbutan-2-yl)-4-(3-methylphenyl)-1-thia-4-azaspiro[4.5]decan-3-one
Chemical Structure Depiction of
8-(2-methylbutan-2-yl)-4-(3-methylphenyl)-1-thia-4-azaspiro[4.5]decan-3-one
8-(2-methylbutan-2-yl)-4-(3-methylphenyl)-1-thia-4-azaspiro[4.5]decan-3-one
Compound characteristics
| Compound ID: | 5441-1164 |
| Compound Name: | 8-(2-methylbutan-2-yl)-4-(3-methylphenyl)-1-thia-4-azaspiro[4.5]decan-3-one |
| Molecular Weight: | 331.52 |
| Molecular Formula: | C20 H29 N O S |
| Smiles: | CCC(C)(C)C1CCC2(CC1)N(C(CS2)=O)c1cccc(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.0006 |
| logD: | 5.0006 |
| logSw: | -4.6454 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 16.1116 |
| InChI Key: | YQKGNTDWYOMBLF-UHFFFAOYSA-N |