4-[5-(4-fluorophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylaniline
Chemical Structure Depiction of
4-[5-(4-fluorophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylaniline
4-[5-(4-fluorophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylaniline
Compound characteristics
| Compound ID: | 5454-0310 |
| Compound Name: | 4-[5-(4-fluorophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylaniline |
| Molecular Weight: | 336.37 |
| Molecular Formula: | C18 H17 F N6 |
| Smiles: | CN(C)c1ccc(cc1)C1C=C(c2ccc(cc2)F)Nc2nnnn12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.483 |
| logD: | 3.3961 |
| logSw: | -3.6839 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.882 |
| InChI Key: | BWYWNHHRDLEPBR-QGZVFWFLSA-N |