2-(4-hydroxyanilino)-5-[(4-methylphenyl)methylidene]-1,3-thiazol-4(5H)-one
Chemical Structure Depiction of
2-(4-hydroxyanilino)-5-[(4-methylphenyl)methylidene]-1,3-thiazol-4(5H)-one
2-(4-hydroxyanilino)-5-[(4-methylphenyl)methylidene]-1,3-thiazol-4(5H)-one
Compound characteristics
| Compound ID: | 5499-0227 |
| Compound Name: | 2-(4-hydroxyanilino)-5-[(4-methylphenyl)methylidene]-1,3-thiazol-4(5H)-one |
| Molecular Weight: | 310.37 |
| Molecular Formula: | C17 H14 N2 O2 S |
| Smiles: | Cc1ccc(/C=C2/C(N=C(Nc3ccc(cc3)O)S2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.5288 |
| logD: | 3.5279 |
| logSw: | -3.6944 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.241 |
| InChI Key: | XYSYDMMREDCLCR-UHFFFAOYSA-N |