9-{3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl}-3,3,6,6-tetramethyl-3,4,6,7,9,10-hexahydroacridine-1,8(2H,5H)-dione
Chemical Structure Depiction of
9-{3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl}-3,3,6,6-tetramethyl-3,4,6,7,9,10-hexahydroacridine-1,8(2H,5H)-dione
9-{3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl}-3,3,6,6-tetramethyl-3,4,6,7,9,10-hexahydroacridine-1,8(2H,5H)-dione
Compound characteristics
| Compound ID: | 5547-0274 |
| Compound Name: | 9-{3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl}-3,3,6,6-tetramethyl-3,4,6,7,9,10-hexahydroacridine-1,8(2H,5H)-dione |
| Molecular Weight: | 513.68 |
| Molecular Formula: | C33 H39 N O4 |
| Smiles: | CCOc1cc(ccc1OCc1ccc(C)cc1)C1C2=C(CC(C)(C)CC2=O)NC2CC(C)(C)CC(C1=2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7996 |
| logD: | 1.3537 |
| logSw: | -5.5521 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.013 |
| InChI Key: | OLGJABKDULWYMF-UHFFFAOYSA-N |