N'-(benzenesulfonyl)-4-chloro-N-(4-methoxyphenyl)benzene-1-carboximidamide
Chemical Structure Depiction of
N'-(benzenesulfonyl)-4-chloro-N-(4-methoxyphenyl)benzene-1-carboximidamide
N'-(benzenesulfonyl)-4-chloro-N-(4-methoxyphenyl)benzene-1-carboximidamide
Compound characteristics
| Compound ID: | 5563-0085 |
| Compound Name: | N'-(benzenesulfonyl)-4-chloro-N-(4-methoxyphenyl)benzene-1-carboximidamide |
| Molecular Weight: | 400.88 |
| Molecular Formula: | C20 H17 Cl N2 O3 S |
| Smiles: | COc1ccc(cc1)NC(\c1ccc(cc1)[Cl])=N/S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8478 |
| logD: | 4.8451 |
| logSw: | -5.009 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.233 |
| InChI Key: | GODAIBYIPIXJAE-UHFFFAOYSA-N |