heptyl 5-[(2,4-dimethylbenzene-1-sulfonyl)amino]-2-methyl-1-benzofuran-3-carboxylate
Chemical Structure Depiction of
heptyl 5-[(2,4-dimethylbenzene-1-sulfonyl)amino]-2-methyl-1-benzofuran-3-carboxylate
heptyl 5-[(2,4-dimethylbenzene-1-sulfonyl)amino]-2-methyl-1-benzofuran-3-carboxylate
Compound characteristics
| Compound ID: | 5591-0414 |
| Compound Name: | heptyl 5-[(2,4-dimethylbenzene-1-sulfonyl)amino]-2-methyl-1-benzofuran-3-carboxylate |
| Molecular Weight: | 457.59 |
| Molecular Formula: | C25 H31 N O5 S |
| Smiles: | CCCCCCCOC(c1c2cc(ccc2oc1C)NS(c1ccc(C)cc1C)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 7.2644 |
| logD: | 7.0711 |
| logSw: | -5.6065 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.883 |
| InChI Key: | GZFYYDVKFYVLGM-UHFFFAOYSA-N |