benzyl 2-methyl-5-[(naphthalene-2-sulfonyl)amino]-1-benzofuran-3-carboxylate
Chemical Structure Depiction of
benzyl 2-methyl-5-[(naphthalene-2-sulfonyl)amino]-1-benzofuran-3-carboxylate
benzyl 2-methyl-5-[(naphthalene-2-sulfonyl)amino]-1-benzofuran-3-carboxylate
Compound characteristics
| Compound ID: | 5591-1830 |
| Compound Name: | benzyl 2-methyl-5-[(naphthalene-2-sulfonyl)amino]-1-benzofuran-3-carboxylate |
| Molecular Weight: | 471.53 |
| Molecular Formula: | C27 H21 N O5 S |
| Smiles: | Cc1c(C(=O)OCc2ccccc2)c2cc(ccc2o1)NS(c1ccc2ccccc2c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.9545 |
| logD: | 5.7812 |
| logSw: | -6.7774 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.422 |
| InChI Key: | SKAAOJPQLKXICH-UHFFFAOYSA-N |