pentyl 2-methyl-5-[(2,4,5-trimethylbenzene-1-sulfonyl)amino]naphtho[1,2-b]furan-3-carboxylate
Chemical Structure Depiction of
pentyl 2-methyl-5-[(2,4,5-trimethylbenzene-1-sulfonyl)amino]naphtho[1,2-b]furan-3-carboxylate
pentyl 2-methyl-5-[(2,4,5-trimethylbenzene-1-sulfonyl)amino]naphtho[1,2-b]furan-3-carboxylate
Compound characteristics
| Compound ID: | 5591-1887 |
| Compound Name: | pentyl 2-methyl-5-[(2,4,5-trimethylbenzene-1-sulfonyl)amino]naphtho[1,2-b]furan-3-carboxylate |
| Molecular Weight: | 493.62 |
| Molecular Formula: | C28 H31 N O5 S |
| Smiles: | CCCCCOC(c1c2cc(c3ccccc3c2oc1C)NS(c1cc(C)c(C)cc1C)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 7.5921 |
| logD: | 7.5388 |
| logSw: | -5.7793 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.147 |
| InChI Key: | DSQDGQXXDDUYMD-UHFFFAOYSA-N |