pentyl 2-methyl-5-[(thiophene-2-sulfonyl)amino]naphtho[1,2-b]furan-3-carboxylate
Chemical Structure Depiction of
pentyl 2-methyl-5-[(thiophene-2-sulfonyl)amino]naphtho[1,2-b]furan-3-carboxylate
pentyl 2-methyl-5-[(thiophene-2-sulfonyl)amino]naphtho[1,2-b]furan-3-carboxylate
Compound characteristics
| Compound ID: | 5591-2035 |
| Compound Name: | pentyl 2-methyl-5-[(thiophene-2-sulfonyl)amino]naphtho[1,2-b]furan-3-carboxylate |
| Molecular Weight: | 457.57 |
| Molecular Formula: | C23 H23 N O5 S2 |
| Smiles: | CCCCCOC(c1c2cc(c3ccccc3c2oc1C)NS(c1cccs1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.0171 |
| logD: | 6.0153 |
| logSw: | -5.5326 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.165 |
| InChI Key: | DSCPPOSELWUILF-UHFFFAOYSA-N |