methyl 2-({4-[(4-fluorobenzene-1-sulfonyl)imino]-1-oxo-1,4-dihydronaphthalen-2-yl}amino)benzoate
Chemical Structure Depiction of
methyl 2-({4-[(4-fluorobenzene-1-sulfonyl)imino]-1-oxo-1,4-dihydronaphthalen-2-yl}amino)benzoate
methyl 2-({4-[(4-fluorobenzene-1-sulfonyl)imino]-1-oxo-1,4-dihydronaphthalen-2-yl}amino)benzoate
Compound characteristics
| Compound ID: | 5591-2379 |
| Compound Name: | methyl 2-({4-[(4-fluorobenzene-1-sulfonyl)imino]-1-oxo-1,4-dihydronaphthalen-2-yl}amino)benzoate |
| Molecular Weight: | 464.47 |
| Molecular Formula: | C24 H17 F N2 O5 S |
| Smiles: | COC(c1ccccc1NC1=C/C(c2ccccc2C1=O)=N/S(c1ccc(cc1)F)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.736 |
| logD: | 4.6944 |
| logSw: | -4.6733 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.608 |
| InChI Key: | KENCPSFMNQKSIO-UHFFFAOYSA-N |