1-(2,2,4,6-tetramethylquinolin-1(2H)-yl)but-2-en-1-one
Chemical Structure Depiction of
1-(2,2,4,6-tetramethylquinolin-1(2H)-yl)but-2-en-1-one
1-(2,2,4,6-tetramethylquinolin-1(2H)-yl)but-2-en-1-one
Compound characteristics
| Compound ID: | 5594-0673 |
| Compound Name: | 1-(2,2,4,6-tetramethylquinolin-1(2H)-yl)but-2-en-1-one |
| Molecular Weight: | 255.36 |
| Molecular Formula: | C17 H21 N O |
| Smiles: | C/C=C/C(N1c2ccc(C)cc2C(C)=CC1(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.265 |
| logD: | 4.265 |
| logSw: | -4.3757 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 14.0682 |
| InChI Key: | BNIYOKRWDLGTJC-UHFFFAOYSA-N |