N~2~,N~4~-bis(4-fluorophenyl)-6-(4-phenylpiperazin-1-yl)-1,3,5-triazine-2,4-diamine
Chemical Structure Depiction of
N~2~,N~4~-bis(4-fluorophenyl)-6-(4-phenylpiperazin-1-yl)-1,3,5-triazine-2,4-diamine
N~2~,N~4~-bis(4-fluorophenyl)-6-(4-phenylpiperazin-1-yl)-1,3,5-triazine-2,4-diamine
Compound characteristics
| Compound ID: | 5594-3030 |
| Compound Name: | N~2~,N~4~-bis(4-fluorophenyl)-6-(4-phenylpiperazin-1-yl)-1,3,5-triazine-2,4-diamine |
| Molecular Weight: | 459.5 |
| Molecular Formula: | C25 H23 F2 N7 |
| Smiles: | C1CN(CCN1c1ccccc1)c1nc(Nc2ccc(cc2)F)nc(Nc2ccc(cc2)F)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.9285 |
| logD: | 6.9269 |
| logSw: | -6.3487 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.838 |
| InChI Key: | WKLLQULLLHXTPC-UHFFFAOYSA-N |