3-(4-ethoxyphenyl)-N-[(furan-2-yl)methyl]prop-2-enamide
Chemical Structure Depiction of
3-(4-ethoxyphenyl)-N-[(furan-2-yl)methyl]prop-2-enamide
3-(4-ethoxyphenyl)-N-[(furan-2-yl)methyl]prop-2-enamide
Compound characteristics
| Compound ID: | 5596-0555 |
| Compound Name: | 3-(4-ethoxyphenyl)-N-[(furan-2-yl)methyl]prop-2-enamide |
| Molecular Weight: | 271.31 |
| Molecular Formula: | C16 H17 N O3 |
| Smiles: | CCOc1ccc(/C=C/C(NCc2ccco2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.5153 |
| logD: | 3.5153 |
| logSw: | -3.3481 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.311 |
| InChI Key: | BKVZSGXQNLRZDX-UHFFFAOYSA-N |