N-[4-(2-ethylpiperidine-1-sulfonyl)phenyl]-2-(2,4,6-trimethylphenoxy)acetamide
Chemical Structure Depiction of
N-[4-(2-ethylpiperidine-1-sulfonyl)phenyl]-2-(2,4,6-trimethylphenoxy)acetamide
N-[4-(2-ethylpiperidine-1-sulfonyl)phenyl]-2-(2,4,6-trimethylphenoxy)acetamide
Compound characteristics
| Compound ID: | 5606-3733 |
| Compound Name: | N-[4-(2-ethylpiperidine-1-sulfonyl)phenyl]-2-(2,4,6-trimethylphenoxy)acetamide |
| Molecular Weight: | 444.59 |
| Molecular Formula: | C24 H32 N2 O4 S |
| Smiles: | CCC1CCCCN1S(c1ccc(cc1)NC(COc1c(C)cc(C)cc1C)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5115 |
| logD: | 5.5109 |
| logSw: | -5.2265 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.923 |
| InChI Key: | PDKKHHQPHPDPAV-NRFANRHFSA-N |