2-[2-(3-ethoxy-4-hydroxyphenyl)ethenyl]quinolin-8-ol
Chemical Structure Depiction of
2-[2-(3-ethoxy-4-hydroxyphenyl)ethenyl]quinolin-8-ol
2-[2-(3-ethoxy-4-hydroxyphenyl)ethenyl]quinolin-8-ol
Compound characteristics
| Compound ID: | 5617-0419 |
| Compound Name: | 2-[2-(3-ethoxy-4-hydroxyphenyl)ethenyl]quinolin-8-ol |
| Molecular Weight: | 307.35 |
| Molecular Formula: | C19 H17 N O3 |
| Smiles: | CCOc1cc(/C=C/c2ccc3cccc(c3n2)O)ccc1O |
| Stereo: | ACHIRAL |
| logP: | 4.1785 |
| logD: | 4.1742 |
| logSw: | -4.0308 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.87 |
| InChI Key: | XKDYZXIRYYAJCG-UHFFFAOYSA-N |