methyl 4-[(2-chlorophenyl)methylidene]-1-[2-(cyclohex-1-en-1-yl)ethyl]-2-methyl-5-oxo-4,5-dihydro-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
methyl 4-[(2-chlorophenyl)methylidene]-1-[2-(cyclohex-1-en-1-yl)ethyl]-2-methyl-5-oxo-4,5-dihydro-1H-pyrrole-3-carboxylate
methyl 4-[(2-chlorophenyl)methylidene]-1-[2-(cyclohex-1-en-1-yl)ethyl]-2-methyl-5-oxo-4,5-dihydro-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | 5618-4137 |
| Compound Name: | methyl 4-[(2-chlorophenyl)methylidene]-1-[2-(cyclohex-1-en-1-yl)ethyl]-2-methyl-5-oxo-4,5-dihydro-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 385.89 |
| Molecular Formula: | C22 H24 Cl N O3 |
| Smiles: | CC1=C(/C(=C/c2ccccc2[Cl])C(N1CCC1CCCCC=1)=O)C(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.6177 |
| logD: | 4.6177 |
| logSw: | -4.5799 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.281 |
| InChI Key: | WKPYQXYUAGENGL-UHFFFAOYSA-N |