2-(4-chlorophenyl)-5-[(3-fluorophenyl)methylidene][1,3]thiazolo[3,2-b][1,2,4]triazol-6(5H)-one
Chemical Structure Depiction of
2-(4-chlorophenyl)-5-[(3-fluorophenyl)methylidene][1,3]thiazolo[3,2-b][1,2,4]triazol-6(5H)-one
2-(4-chlorophenyl)-5-[(3-fluorophenyl)methylidene][1,3]thiazolo[3,2-b][1,2,4]triazol-6(5H)-one
Compound characteristics
| Compound ID: | 5629-0766 |
| Compound Name: | 2-(4-chlorophenyl)-5-[(3-fluorophenyl)methylidene][1,3]thiazolo[3,2-b][1,2,4]triazol-6(5H)-one |
| Molecular Weight: | 357.79 |
| Molecular Formula: | C17 H9 Cl F N3 O S |
| Smiles: | [H]C(=C1/C(n2c(nc(c3ccc(cc3)[Cl])n2)S1)=O)\c1cccc(c1)F |
| Stereo: | ACHIRAL |
| logP: | 4.708 |
| logD: | 4.708 |
| logSw: | -5.1485 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.196 |
| InChI Key: | YOBFNVBKXGMFEC-UHFFFAOYSA-N |