6-methyl-2-{[4-(methylsulfanyl)phenyl]methylidene}-7H-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7(2H)-dione
Chemical Structure Depiction of
6-methyl-2-{[4-(methylsulfanyl)phenyl]methylidene}-7H-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7(2H)-dione
6-methyl-2-{[4-(methylsulfanyl)phenyl]methylidene}-7H-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7(2H)-dione
Compound characteristics
| Compound ID: | 5629-1200 |
| Compound Name: | 6-methyl-2-{[4-(methylsulfanyl)phenyl]methylidene}-7H-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7(2H)-dione |
| Molecular Weight: | 317.39 |
| Molecular Formula: | C14 H11 N3 O2 S2 |
| Smiles: | [H]C(=C1/C(N2C(=NC(C(C)=N2)=O)S1)=O)\c1ccc(cc1)SC |
| Stereo: | ACHIRAL |
| logP: | 2.4088 |
| logD: | 2.4088 |
| logSw: | -2.5412 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 50.093 |
| InChI Key: | KCEFEUORBWGHRX-UHFFFAOYSA-N |