5-(3,4-dimethylphenyl)-3-(4-methylphenyl)-1,2,4-oxadiazole
Chemical Structure Depiction of
5-(3,4-dimethylphenyl)-3-(4-methylphenyl)-1,2,4-oxadiazole
5-(3,4-dimethylphenyl)-3-(4-methylphenyl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | 5631-1281 |
| Compound Name: | 5-(3,4-dimethylphenyl)-3-(4-methylphenyl)-1,2,4-oxadiazole |
| Molecular Weight: | 264.32 |
| Molecular Formula: | C17 H16 N2 O |
| Smiles: | Cc1ccc(cc1)c1nc(c2ccc(C)c(C)c2)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.5409 |
| logD: | 5.5409 |
| logSw: | -5.513 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 31.644 |
| InChI Key: | ZOMMWBFNUBIYAG-UHFFFAOYSA-N |