1-(benzenesulfonyl)-N-(2-methylphenyl)piperidine-4-carboxamide
Chemical Structure Depiction of
1-(benzenesulfonyl)-N-(2-methylphenyl)piperidine-4-carboxamide
1-(benzenesulfonyl)-N-(2-methylphenyl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | 5641-1529 |
| Compound Name: | 1-(benzenesulfonyl)-N-(2-methylphenyl)piperidine-4-carboxamide |
| Molecular Weight: | 358.46 |
| Molecular Formula: | C19 H22 N2 O3 S |
| Smiles: | Cc1ccccc1NC(C1CCN(CC1)S(c1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6547 |
| logD: | 2.6546 |
| logSw: | -3.0205 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.343 |
| InChI Key: | DKAHANYVNVDSFQ-UHFFFAOYSA-N |