1-(4-methylbenzene-1-sulfonyl)-N-[3-(methylsulfanyl)phenyl]piperidine-4-carboxamide
Chemical Structure Depiction of
1-(4-methylbenzene-1-sulfonyl)-N-[3-(methylsulfanyl)phenyl]piperidine-4-carboxamide
1-(4-methylbenzene-1-sulfonyl)-N-[3-(methylsulfanyl)phenyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | 5641-1649 |
| Compound Name: | 1-(4-methylbenzene-1-sulfonyl)-N-[3-(methylsulfanyl)phenyl]piperidine-4-carboxamide |
| Molecular Weight: | 404.55 |
| Molecular Formula: | C20 H24 N2 O3 S2 |
| Smiles: | Cc1ccc(cc1)S(N1CCC(CC1)C(Nc1cccc(c1)SC)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6306 |
| logD: | 3.6306 |
| logSw: | -3.6562 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.041 |
| InChI Key: | CYZCLUZFHKGWHN-UHFFFAOYSA-N |