5-({3-methoxy-4-[(prop-2-en-1-yl)oxy]phenyl}methylidene)-3-[2-(morpholin-4-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
5-({3-methoxy-4-[(prop-2-en-1-yl)oxy]phenyl}methylidene)-3-[2-(morpholin-4-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione
5-({3-methoxy-4-[(prop-2-en-1-yl)oxy]phenyl}methylidene)-3-[2-(morpholin-4-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | 5648-2220 |
| Compound Name: | 5-({3-methoxy-4-[(prop-2-en-1-yl)oxy]phenyl}methylidene)-3-[2-(morpholin-4-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 418.47 |
| Molecular Formula: | C20 H22 N2 O6 S |
| Smiles: | COc1cc(/C=C2/C(N(CC(N3CCOCC3)=O)C(=O)S2)=O)ccc1OCC=C |
| Stereo: | ACHIRAL |
| logP: | 1.8166 |
| logD: | 1.8166 |
| logSw: | -2.5202 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 69.031 |
| InChI Key: | DYIFIESGWVUELZ-UHFFFAOYSA-N |