5-bromo-4-chloro-2-{[3-(methylsulfanyl)anilino]methylidene}-1,2-dihydro-3H-indol-3-one
Chemical Structure Depiction of
5-bromo-4-chloro-2-{[3-(methylsulfanyl)anilino]methylidene}-1,2-dihydro-3H-indol-3-one
5-bromo-4-chloro-2-{[3-(methylsulfanyl)anilino]methylidene}-1,2-dihydro-3H-indol-3-one
Compound characteristics
| Compound ID: | 5682-0136 |
| Compound Name: | 5-bromo-4-chloro-2-{[3-(methylsulfanyl)anilino]methylidene}-1,2-dihydro-3H-indol-3-one |
| Molecular Weight: | 395.7 |
| Molecular Formula: | C16 H12 Br Cl N2 O S |
| Smiles: | CSc1cccc(c1)N\C=C1/C(c2c(ccc(c2[Cl])[Br])N1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1113 |
| logD: | 5.1005 |
| logSw: | -5.7664 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 36.26 |
| InChI Key: | GKFPJXBQTWWWPX-MDWZMJQESA-N |