methyl {4-[(4-hydroxyphenyl)imino]-2-oxo-1,3-thiazolidin-5-yl}acetate
Chemical Structure Depiction of
methyl {4-[(4-hydroxyphenyl)imino]-2-oxo-1,3-thiazolidin-5-yl}acetate
methyl {4-[(4-hydroxyphenyl)imino]-2-oxo-1,3-thiazolidin-5-yl}acetate
Compound characteristics
| Compound ID: | 5685-0405 |
| Compound Name: | methyl {4-[(4-hydroxyphenyl)imino]-2-oxo-1,3-thiazolidin-5-yl}acetate |
| Molecular Weight: | 280.3 |
| Molecular Formula: | C12 H12 N2 O4 S |
| Smiles: | COC(CC1/C(NC(=O)S1)=N/c1ccc(cc1)O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.1585 |
| logD: | 1.147 |
| logSw: | -2.047 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.539 |
| InChI Key: | ZJHUSXBBRXZGNA-VIFPVBQESA-N |