ethyl 4-({2-[(4-chlorobenzoyl)oxy]ethyl}amino)benzo[h]quinoline-3-carboxylate
Chemical Structure Depiction of
ethyl 4-({2-[(4-chlorobenzoyl)oxy]ethyl}amino)benzo[h]quinoline-3-carboxylate
ethyl 4-({2-[(4-chlorobenzoyl)oxy]ethyl}amino)benzo[h]quinoline-3-carboxylate
Compound characteristics
| Compound ID: | 5694-1137 |
| Compound Name: | ethyl 4-({2-[(4-chlorobenzoyl)oxy]ethyl}amino)benzo[h]quinoline-3-carboxylate |
| Molecular Weight: | 448.91 |
| Molecular Formula: | C25 H21 Cl N2 O4 |
| Smiles: | CCOC(c1cnc2c3ccccc3ccc2c1NCCOC(c1ccc(cc1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.2671 |
| logD: | 6.2669 |
| logSw: | -6.2883 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.072 |
| InChI Key: | DNPYBYWOSCUFIY-UHFFFAOYSA-N |